C27H21FN4OS — CID 148617577
(5aR,6R,9aS)-1-(1,3-benzothiazol-2-yl)-3-(2-fluorophenyl)-6,9a-dimethyl-7-oxo-4,5,5a,6-tetrahydrobenzo[g]indazole-8-carbonitrile (PubChem CID 148617577) has the molecular formula C27H21FN4OS and a molecular weight of 468.56 g/mol. Its IUPAC name is (5aR,6R,9aS)-1-(1,3-benzothiazol-2-yl)-3-(2-fluorophenyl)-6,9a-dimethyl-7-oxo-4,5,5a,6-tetrahydrobenzo[g]indazole-8-carbonitrile.
| Compound Name | (5aR,6R,9aS)-1-(1,3-benzothiazol-2-yl)-3-(2-fluorophenyl)-6,9a-dimethyl-7-oxo-4,5,5a,6-tetrahydrobenzo[g]indazole-8-carbonitrile |
|---|---|
| PubChem CID | 148617577 |
| Molecular Formula | C27H21FN4OS |
| Molecular Weight | 468.56 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | (5aR,6R,9aS)-1-(1,3-benzothiazol-2-yl)-3-(2-fluorophenyl)-6,9a-dimethyl-7-oxo-4,5,5a,6-tetrahydrobenzo[g]indazole-8-carbonitrile |
| SMILES | C[C@H]1C(=O)C(C#N)=C[C@@]2(C)c3c(c(-c4ccccc4F)nn3-c3nc4ccccc4s3)CC[C@H]12 |
| InChI | InChI=1S/C27H21FN4OS/c1-15-19-12-11-18-23(17-7-3-4-8-20(17)28)31-32(26-30-21-9-5-6-10-22(21)34-26)25(18)27(19,2)13-16(14-29)24(15)33/h3-10,13,15,19H,11-12H2,1-2H3/t15-,19-,27-/m1/s1 |
| InChIKey | NFPJGISKWVBNSB-NIGURAHDSA-N |
| XLogP | 5.78 |
| TPSA | 71.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.56 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |