C19H23N3O2 — CID 148618369
4-[2-[(3aR,6aS)-5-pyrazin-2-yloxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]ethyl]phenol (PubChem CID 148618369) has the molecular formula C19H23N3O2 and a molecular weight of 325.41 g/mol. Its IUPAC name is 4-[2-[(3aR,6aS)-5-pyrazin-2-yloxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]ethyl]phenol.
| Compound Name | 4-[2-[(3aR,6aS)-5-pyrazin-2-yloxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]ethyl]phenol |
|---|---|
| PubChem CID | 148618369 |
| Molecular Formula | C19H23N3O2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | 4-[2-[(3aR,6aS)-5-pyrazin-2-yloxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]ethyl]phenol |
| SMILES | Oc1ccc(CCN2C[C@H]3CC(Oc4cnccn4)C[C@H]3C2)cc1 |
| InChI | InChI=1S/C19H23N3O2/c23-17-3-1-14(2-4-17)5-8-22-12-15-9-18(10-16(15)13-22)24-19-11-20-6-7-21-19/h1-4,6-7,11,15-16,18,23H,5,8-10,12-13H2/t15-,16+,18? |
| InChIKey | NFTKWELYDOOVRQ-BYICEURKSA-N |
| XLogP | 2.51 |
| TPSA | 58.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |