C18H14O2 — CID 148621381
pentacyclo[9.6.0.01,4.05,10.012,17]heptadeca-5,7,9,12,14,16-hexaene-3-carboxylic acid (PubChem CID 148621381) has the molecular formula C18H14O2 and a molecular weight of 262.31 g/mol. Its IUPAC name is pentacyclo[9.6.0.01,4.05,10.012,17]heptadeca-5,7,9,12,14,16-hexaene-3-carboxylic acid.
| Compound Name | pentacyclo[9.6.0.01,4.05,10.012,17]heptadeca-5,7,9,12,14,16-hexaene-3-carboxylic acid |
|---|---|
| PubChem CID | 148621381 |
| Molecular Formula | C18H14O2 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | pentacyclo[9.6.0.01,4.05,10.012,17]heptadeca-5,7,9,12,14,16-hexaene-3-carboxylic acid |
| SMILES | O=C(O)C1CC23c4ccccc4C2c2ccccc2C13 |
| InChI | InChI=1S/C18H14O2/c19-17(20)13-9-18-14-8-4-3-7-12(14)15(18)10-5-1-2-6-11(10)16(13)18/h1-8,13,15-16H,9H2,(H,19,20) |
| InChIKey | NGIKOXFWKUVJCH-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |