C46H28N4S2 — CID 148624256
2-[9-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]dibenzothiophen-1-yl]-1,3-benzothiazole (PubChem CID 148624256) has the molecular formula C46H28N4S2 and a molecular weight of 700.89 g/mol. Its IUPAC name is 2-[9-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]dibenzothiophen-1-yl]-1,3-benzothiazole.
| Compound Name | 2-[9-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]dibenzothiophen-1-yl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 148624256 |
| Molecular Formula | C46H28N4S2 |
| Molecular Weight | 700.89 g/mol |
| Exact Mass | 700.18 |
| IUPAC Name | 2-[9-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]dibenzothiophen-1-yl]-1,3-benzothiazole |
| SMILES | c1ccc(-c2ccc(-c3nc(-c4ccc(-c5ccccc5)cc4)nc(-c4cccc5sc6cccc(-c7nc8ccccc8s7)c6c45)n3)cc2)cc1 |
| InChI | InChI=1S/C46H28N4S2/c1-3-11-29(12-4-1)31-21-25-33(26-22-31)43-48-44(34-27-23-32(24-28-34)30-13-5-2-6-14-30)50-45(49-43)35-15-9-19-39-41(35)42-36(16-10-20-40(42)51-39)46-47-37-17-7-8-18-38(37)52-46/h1-28H |
| InChIKey | NGWPFQXVVAAKGF-UHFFFAOYSA-N |
| XLogP | 12.85 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.89 |
| LogP ≤ 5 | 12.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |