About pentan-3-amine;uranium(2+)
pentan-3-amine;uranium(2+) (PubChem CID 148626770) has the molecular formula C5H11NU
and a molecular weight of 323.18 g/mol. Its IUPAC name is pentan-3-amine;uranium(2+).
Molecular Properties
| Compound Name | pentan-3-amine;uranium(2+) |
| PubChem CID | 148626770 |
| Molecular Formula | C5H11NU |
| Molecular Weight | 323.18 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | pentan-3-amine;uranium(2+) |
| SMILES | [CH2-]CC(N)C[CH2-].[U+2] |
| InChI | InChI=1S/C5H11N.U/c1-3-5(6)4-2;/h5H,1-4,6H2;/q-2;+2 |
| InChIKey | WVJRALBLPAZONP-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.18 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze pentan-3-amine;uranium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentan-3-amine;uranium(2+)?
The IUPAC name of pentan-3-amine;uranium(2+) (CID 148626770) is pentan-3-amine;uranium(2+).
What is the SMILES notation for pentan-3-amine;uranium(2+)?
The canonical SMILES for pentan-3-amine;uranium(2+) is [CH2-]CC(N)C[CH2-].[U+2].
What is the InChIKey of pentan-3-amine;uranium(2+)?
The InChIKey is WVJRALBLPAZONP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11N.U/c1-3-5(6)4-2;/h5H,1-4,6H2;/q-2;+2.
What are the key properties of pentan-3-amine;uranium(2+)?
pentan-3-amine;uranium(2+) has a molecular weight of 323.18 g/mol, XLogP of 0.76, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for pentan-3-amine;uranium(2+) is sourced from PubChem (CID 148626770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).