About 1-O-methyl 2-O-[4,4,4-trifluoro-3-(trifluoromethyl)but-2-enyl] oxalate
1-O-methyl 2-O-[4,4,4-trifluoro-3-(trifluoromethyl)but-2-enyl] oxalate (PubChem CID 148630852) has the molecular formula C8H6F6O4
and a molecular weight of 280.12 g/mol. Its IUPAC name is 1-O-methyl 2-O-[4,4,4-trifluoro-3-(trifluoromethyl)but-2-enyl] oxalate.
Molecular Properties
| Compound Name | 1-O-methyl 2-O-[4,4,4-trifluoro-3-(trifluoromethyl)but-2-enyl] oxalate |
| PubChem CID | 148630852 |
| Molecular Formula | C8H6F6O4 |
| Molecular Weight | 280.12 g/mol |
| Exact Mass | 280.02 |
| IUPAC Name | 1-O-methyl 2-O-[4,4,4-trifluoro-3-(trifluoromethyl)but-2-enyl] oxalate |
| SMILES | COC(=O)C(=O)OCC=C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H6F6O4/c1-17-5(15)6(16)18-3-2-4(7(9,10)11)8(12,13)14/h2H,3H2,1H3 |
| InChIKey | NICPFYSOCLQSOG-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.12 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-O-methyl 2-O-[4,4,4-trifluoro-3-(trifluoromethyl)but-2-enyl] oxalate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-methyl 2-O-[4,4,4-trifluoro-3-(trifluoromethyl)but-2-enyl] oxalate?
The IUPAC name of 1-O-methyl 2-O-[4,4,4-trifluoro-3-(trifluoromethyl)but-2-enyl] oxalate (CID 148630852) is 1-O-methyl 2-O-[4,4,4-trifluoro-3-(trifluoromethyl)but-2-enyl] oxalate.
What is the SMILES notation for 1-O-methyl 2-O-[4,4,4-trifluoro-3-(trifluoromethyl)but-2-enyl] oxalate?
The canonical SMILES for 1-O-methyl 2-O-[4,4,4-trifluoro-3-(trifluoromethyl)but-2-enyl] oxalate is COC(=O)C(=O)OCC=C(C(F)(F)F)C(F)(F)F.
What is the InChIKey of 1-O-methyl 2-O-[4,4,4-trifluoro-3-(trifluoromethyl)but-2-enyl] oxalate?
The InChIKey is NICPFYSOCLQSOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6F6O4/c1-17-5(15)6(16)18-3-2-4(7(9,10)11)8(12,13)14/h2H,3H2,1H3.
What are the key properties of 1-O-methyl 2-O-[4,4,4-trifluoro-3-(trifluoromethyl)but-2-enyl] oxalate?
1-O-methyl 2-O-[4,4,4-trifluoro-3-(trifluoromethyl)but-2-enyl] oxalate has a molecular weight of 280.12 g/mol, XLogP of 1.75, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-methyl 2-O-[4,4,4-trifluoro-3-(trifluoromethyl)but-2-enyl] oxalate is sourced from PubChem (CID 148630852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).