C22H25FI2N6O2SU — CID 148631194
(1R,2R)-1-[(4R)-2-butyl-4,5-dihydro-1,3-thiazol-5-id-4-yl]-4-[4-[[2-[fluoro(diiodo)methyl]benzimidazol-1-yl]methyl]triazol-1-yl]butane-1,2-diol;uranium(2+) (PubChem CID 148631194) has the molecular formula C22H25FI2N6O2SU and a molecular weight of 948.38 g/mol. Its IUPAC name is (1R,2R)-1-[(4R)-2-butyl-4,5-dihydro-1,3-thiazol-5-id-4-yl]-4-[4-[[2-[fluoro(diiodo)methyl]benzimidazol-1-yl]methyl]triazol-1-yl]butane-1,2-diol;uranium(2+).
| Compound Name | (1R,2R)-1-[(4R)-2-butyl-4,5-dihydro-1,3-thiazol-5-id-4-yl]-4-[4-[[2-[fluoro(diiodo)methyl]benzimidazol-1-yl]methyl]triazol-1-yl]butane-1,2-diol;uranium(2+) |
|---|---|
| PubChem CID | 148631194 |
| Molecular Formula | C22H25FI2N6O2SU |
| Molecular Weight | 948.38 g/mol |
| Exact Mass | 948.03 |
| IUPAC Name | (1R,2R)-1-[(4R)-2-butyl-4,5-dihydro-1,3-thiazol-5-id-4-yl]-4-[4-[[2-[fluoro(diiodo)methyl]benzimidazol-1-yl]methyl]triazol-1-yl]butane-1,2-diol;uranium(2+) |
| SMILES | CCCCC1=N[C@H]([C@@H](O)[C@H](O)[CH-]Cn2cc(Cn3c(C(F)(I)I)nc4ccccc43)nn2)[CH-]S1.[U+2] |
| InChI | InChI=1S/C22H25FI2N6O2S.U/c1-2-3-8-19-26-16(13-34-19)20(33)18(32)9-10-30-11-14(28-29-30)12-31-17-7-5-4-6-15(17)27-21(31)22(23,24)25;/h4-7,9,11,13,16,18,20,32-33H,2-3,8,10,12H2,1H3;/q-2;+2/t16-,18+,20+;/m0./s1 |
| InChIKey | VNYXYOMWCDDIIS-DNHMSYDNSA-N |
| XLogP | 4.42 |
| TPSA | 101.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 948.38 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|