C26H48O2Si2 — CID 14863121
trimethyl-[(2,10,13-trimethyl-3-trimethylsilyloxy-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)oxy]silane (PubChem CID 14863121) has the molecular formula C26H48O2Si2 and a molecular weight of 448.84 g/mol. Its IUPAC name is trimethyl-[(2,10,13-trimethyl-3-trimethylsilyloxy-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)oxy]silane.
| Compound Name | trimethyl-[(2,10,13-trimethyl-3-trimethylsilyloxy-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)oxy]silane |
|---|---|
| PubChem CID | 14863121 |
| Molecular Formula | C26H48O2Si2 |
| Molecular Weight | 448.84 g/mol |
| Exact Mass | 448.32 |
| IUPAC Name | trimethyl-[(2,10,13-trimethyl-3-trimethylsilyloxy-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)oxy]silane |
| SMILES | CC1CC2(C)C(CCC3C4CC=C(O[Si](C)(C)C)C4(C)CCC32)CC1O[Si](C)(C)C |
| InChI | InChI=1S/C26H48O2Si2/c1-18-17-26(3)19(16-23(18)27-29(4,5)6)10-11-20-21-12-13-24(28-30(7,8)9)25(21,2)15-14-22(20)26/h13,18-23H,10-12,14-17H2,1-9H3 |
| InChIKey | FVUKZIHAFPJDBP-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.84 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|