C20H32N4O4 — CID 14863208
3,12-di(propan-2-yl)-1,4,10,13-tetrazatricyclo[13.3.0.06,10]octadecane-2,5,11,14-tetrone (PubChem CID 14863208) has the molecular formula C20H32N4O4 and a molecular weight of 392.50 g/mol. Its IUPAC name is 3,12-di(propan-2-yl)-1,4,10,13-tetrazatricyclo[13.3.0.06,10]octadecane-2,5,11,14-tetrone.
| Compound Name | 3,12-di(propan-2-yl)-1,4,10,13-tetrazatricyclo[13.3.0.06,10]octadecane-2,5,11,14-tetrone |
|---|---|
| PubChem CID | 14863208 |
| Molecular Formula | C20H32N4O4 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.24 |
| IUPAC Name | 3,12-di(propan-2-yl)-1,4,10,13-tetrazatricyclo[13.3.0.06,10]octadecane-2,5,11,14-tetrone |
| SMILES | CC(C)C1NC(=O)C2CCCN2C(=O)C(C(C)C)NC(=O)C2CCCN2C1=O |
| InChI | InChI=1S/C20H32N4O4/c1-11(2)15-19(27)23-9-5-8-14(23)18(26)22-16(12(3)4)20(28)24-10-6-7-13(24)17(25)21-15/h11-16H,5-10H2,1-4H3,(H,21,25)(H,22,26) |
| InChIKey | JDQWFMXPVVWMMH-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |