C29H26N6O — CID 148633211
(5aR,6R,9aS)-6,9a-dimethyl-3-(1-methylpyrazol-4-yl)-7-oxo-2-(3-pyridin-4-ylphenyl)-4,5,5a,6-tetrahydrobenzo[e]benzimidazole-8-carbonitrile (PubChem CID 148633211) has the molecular formula C29H26N6O and a molecular weight of 474.57 g/mol. Its IUPAC name is (5aR,6R,9aS)-6,9a-dimethyl-3-(1-methylpyrazol-4-yl)-7-oxo-2-(3-pyridin-4-ylphenyl)-4,5,5a,6-tetrahydrobenzo[e]benzimidazole-8-carbonitrile.
| Compound Name | (5aR,6R,9aS)-6,9a-dimethyl-3-(1-methylpyrazol-4-yl)-7-oxo-2-(3-pyridin-4-ylphenyl)-4,5,5a,6-tetrahydrobenzo[e]benzimidazole-8-carbonitrile |
|---|---|
| PubChem CID | 148633211 |
| Molecular Formula | C29H26N6O |
| Molecular Weight | 474.57 g/mol |
| Exact Mass | 474.22 |
| IUPAC Name | (5aR,6R,9aS)-6,9a-dimethyl-3-(1-methylpyrazol-4-yl)-7-oxo-2-(3-pyridin-4-ylphenyl)-4,5,5a,6-tetrahydrobenzo[e]benzimidazole-8-carbonitrile |
| SMILES | C[C@H]1C(=O)C(C#N)=C[C@@]2(C)c3nc(-c4cccc(-c5ccncc5)c4)n(-c4cnn(C)c4)c3CC[C@H]12 |
| InChI | InChI=1S/C29H26N6O/c1-18-24-7-8-25-27(29(24,2)14-22(15-30)26(18)36)33-28(35(25)23-16-32-34(3)17-23)21-6-4-5-20(13-21)19-9-11-31-12-10-19/h4-6,9-14,16-18,24H,7-8H2,1-3H3/t18-,24-,29-/m1/s1 |
| InChIKey | NIOCKDCEZIKOJD-QIYJARMZSA-N |
| XLogP | 4.82 |
| TPSA | 89.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.57 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |