C20H26FN5O3S — CID 148633521
(3-amino-6-tert-butylsulfonyl-5,7-dihydro-4H-pyrazolo[3,4-c]pyridin-2-yl)-(6-fluoro-1,2,3,4-tetrahydroquinolin-4-yl)methanone (PubChem CID 148633521) has the molecular formula C20H26FN5O3S and a molecular weight of 435.53 g/mol. Its IUPAC name is (3-amino-6-tert-butylsulfonyl-5,7-dihydro-4H-pyrazolo[3,4-c]pyridin-2-yl)-(6-fluoro-1,2,3,4-tetrahydroquinolin-4-yl)methanone.
| Compound Name | (3-amino-6-tert-butylsulfonyl-5,7-dihydro-4H-pyrazolo[3,4-c]pyridin-2-yl)-(6-fluoro-1,2,3,4-tetrahydroquinolin-4-yl)methanone |
|---|---|
| PubChem CID | 148633521 |
| Molecular Formula | C20H26FN5O3S |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | (3-amino-6-tert-butylsulfonyl-5,7-dihydro-4H-pyrazolo[3,4-c]pyridin-2-yl)-(6-fluoro-1,2,3,4-tetrahydroquinolin-4-yl)methanone |
| SMILES | CC(C)(C)S(=O)(=O)N1CCc2c(nn(C(=O)C3CCNc4ccc(F)cc43)c2N)C1 |
| InChI | InChI=1S/C20H26FN5O3S/c1-20(2,3)30(28,29)25-9-7-14-17(11-25)24-26(18(14)22)19(27)13-6-8-23-16-5-4-12(21)10-15(13)16/h4-5,10,13,23H,6-9,11,22H2,1-3H3 |
| InChIKey | NIPMXZWNFKJAOZ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 110.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |