C36H33F2N3O10S2 — CID 148634858
2-[2-[4-[3,4-bis[[4-(morpholine-4-carbonyl)phenyl]sulfanyl]-2,5-dioxopyrrol-1-yl]-2,6-difluorophenoxy]ethoxy]acetic acid (PubChem CID 148634858) has the molecular formula C36H33F2N3O10S2 and a molecular weight of 769.80 g/mol. Its IUPAC name is 2-[2-[4-[3,4-bis[[4-(morpholine-4-carbonyl)phenyl]sulfanyl]-2,5-dioxopyrrol-1-yl]-2,6-difluorophenoxy]ethoxy]acetic acid.
| Compound Name | 2-[2-[4-[3,4-bis[[4-(morpholine-4-carbonyl)phenyl]sulfanyl]-2,5-dioxopyrrol-1-yl]-2,6-difluorophenoxy]ethoxy]acetic acid |
|---|---|
| PubChem CID | 148634858 |
| Molecular Formula | C36H33F2N3O10S2 |
| Molecular Weight | 769.80 g/mol |
| Exact Mass | 769.16 |
| IUPAC Name | 2-[2-[4-[3,4-bis[[4-(morpholine-4-carbonyl)phenyl]sulfanyl]-2,5-dioxopyrrol-1-yl]-2,6-difluorophenoxy]ethoxy]acetic acid |
| SMILES | O=C(O)COCCOc1c(F)cc(N2C(=O)C(Sc3ccc(C(=O)N4CCOCC4)cc3)=C(Sc3ccc(C(=O)N4CCOCC4)cc3)C2=O)cc1F |
| InChI | InChI=1S/C36H33F2N3O10S2/c37-27-19-24(20-28(38)30(27)51-18-17-50-21-29(42)43)41-35(46)31(52-25-5-1-22(2-6-25)33(44)39-9-13-48-14-10-39)32(36(41)47)53-26-7-3-23(4-8-26)34(45)40-11-15-49-16-12-40/h1-8,19-20H,9-18,21H2,(H,42,43) |
| InChIKey | NIWGUONALJDFEW-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 152.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 769.80 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|