C29H26Cl2F3N3O — CID 148636117
6-[bis(4-chlorophenyl)methyl]-4-[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]amino]quinolin-8-ol (PubChem CID 148636117) has the molecular formula C29H26Cl2F3N3O and a molecular weight of 560.45 g/mol. Its IUPAC name is 6-[bis(4-chlorophenyl)methyl]-4-[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]amino]quinolin-8-ol.
| Compound Name | 6-[bis(4-chlorophenyl)methyl]-4-[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]amino]quinolin-8-ol |
|---|---|
| PubChem CID | 148636117 |
| Molecular Formula | C29H26Cl2F3N3O |
| Molecular Weight | 560.45 g/mol |
| Exact Mass | 559.14 |
| IUPAC Name | 6-[bis(4-chlorophenyl)methyl]-4-[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]amino]quinolin-8-ol |
| SMILES | Oc1cc(C(c2ccc(Cl)cc2)c2ccc(Cl)cc2)cc2c(NC3CCN(CC(F)(F)F)CC3)ccnc12 |
| InChI | InChI=1S/C29H26Cl2F3N3O/c30-21-5-1-18(2-6-21)27(19-3-7-22(31)8-4-19)20-15-24-25(9-12-35-28(24)26(38)16-20)36-23-10-13-37(14-11-23)17-29(32,33)34/h1-9,12,15-16,23,27,38H,10-11,13-14,17H2,(H,35,36) |
| InChIKey | NJCLIPTZFRJVCU-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.45 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|