C30H52O5Si — CID 14863801
(1S,3R,7S,8S,8aR)-8-[2-[(2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-6-(oxan-2-yloxy)oxan-2-yl]ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-ol (PubChem CID 14863801) has the molecular formula C30H52O5Si and a molecular weight of 520.83 g/mol. Its IUPAC name is (1S,3R,7S,8S,8aR)-8-[2-[(2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-6-(oxan-2-yloxy)oxan-2-yl]ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-ol.
| Compound Name | (1S,3R,7S,8S,8aR)-8-[2-[(2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-6-(oxan-2-yloxy)oxan-2-yl]ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-ol |
|---|---|
| PubChem CID | 14863801 |
| Molecular Formula | C30H52O5Si |
| Molecular Weight | 520.83 g/mol |
| Exact Mass | 520.36 |
| IUPAC Name | (1S,3R,7S,8S,8aR)-8-[2-[(2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-6-(oxan-2-yloxy)oxan-2-yl]ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-ol |
| SMILES | C[C@H]1C=C2C=C[C@H](C)[C@H](CC[C@@H]3C[C@@H](O[Si](C)(C)C(C)(C)C)CC(OC4CCCCO4)O3)[C@H]2[C@@H](O)C1 |
| InChI | InChI=1S/C30H52O5Si/c1-20-16-22-12-11-21(2)25(29(22)26(31)17-20)14-13-23-18-24(35-36(6,7)30(3,4)5)19-28(33-23)34-27-10-8-9-15-32-27/h11-12,16,20-21,23-29,31H,8-10,13-15,17-19H2,1-7H3/t20-,21-,23+,24+,25-,26-,27?,28?,29-/m0/s1 |
| InChIKey | DTUIHZOCMPTXJU-LPIZSJEHSA-N |
| XLogP | 6.97 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.83 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|