C26H38O15 — CID 148638377
[(5S)-3,4,5-triacetyloxy-6-(3,4-diacetyloxy-6-ethyl-5-methyloxan-2-yl)oxyoxan-2-yl]methyl acetate (PubChem CID 148638377) has the molecular formula C26H38O15 and a molecular weight of 590.58 g/mol. Its IUPAC name is [(5S)-3,4,5-triacetyloxy-6-(3,4-diacetyloxy-6-ethyl-5-methyloxan-2-yl)oxyoxan-2-yl]methyl acetate.
| Compound Name | [(5S)-3,4,5-triacetyloxy-6-(3,4-diacetyloxy-6-ethyl-5-methyloxan-2-yl)oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 148638377 |
| Molecular Formula | C26H38O15 |
| Molecular Weight | 590.58 g/mol |
| Exact Mass | 590.22 |
| IUPAC Name | [(5S)-3,4,5-triacetyloxy-6-(3,4-diacetyloxy-6-ethyl-5-methyloxan-2-yl)oxyoxan-2-yl]methyl acetate |
| SMILES | CCC1OC(OC2OC(COC(C)=O)C(OC(C)=O)C(OC(C)=O)[C@@H]2OC(C)=O)C(OC(C)=O)C(OC(C)=O)C1C |
| InChI | InChI=1S/C26H38O15/c1-9-18-11(2)20(34-13(4)28)23(37-16(7)31)25(39-18)41-26-24(38-17(8)32)22(36-15(6)30)21(35-14(5)29)19(40-26)10-33-12(3)27/h11,18-26H,9-10H2,1-8H3/t11?,18?,19?,20?,21?,22?,23?,24-,25?,26?/m0/s1 |
| InChIKey | NJNHCMPMWSAXAG-AFWBCNCLSA-N |
| XLogP | 0.72 |
| TPSA | 185.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.58 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|