C8H13NO5 — CID 14863933
(1R,2R,3S,7S,8R)-1,2,7-trihydroxy-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-3-carboxylic acid (PubChem CID 14863933) has the molecular formula C8H13NO5 and a molecular weight of 203.19 g/mol. Its IUPAC name is (1R,2R,3S,7S,8R)-1,2,7-trihydroxy-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-3-carboxylic acid.
| Compound Name | (1R,2R,3S,7S,8R)-1,2,7-trihydroxy-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-3-carboxylic acid |
|---|---|
| PubChem CID | 14863933 |
| Molecular Formula | C8H13NO5 |
| Molecular Weight | 203.19 g/mol |
| Exact Mass | 203.08 |
| IUPAC Name | (1R,2R,3S,7S,8R)-1,2,7-trihydroxy-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-3-carboxylic acid |
| SMILES | O=C(O)[C@@H]1[C@@H](O)[C@H](O)[C@H]2[C@@H](O)CCN21 |
| InChI | InChI=1S/C8H13NO5/c10-3-1-2-9-4(3)6(11)7(12)5(9)8(13)14/h3-7,10-12H,1-2H2,(H,13,14)/t3-,4+,5-,6+,7+/m0/s1 |
| InChIKey | VTIRMWCDXGHHAD-PJEQPVAWSA-N |
| XLogP | -2.39 |
| TPSA | 101.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.19 |
| LogP ≤ 5 | -2.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |