C20H28O2 — CID 14864253
7-ethenyl-1,1,4a,8-tetramethyl-3,4,4b,5,8a,9,10,10a-octahydrophenanthrene-2,6-dione (PubChem CID 14864253) has the molecular formula C20H28O2 and a molecular weight of 300.44 g/mol. Its IUPAC name is 7-ethenyl-1,1,4a,8-tetramethyl-3,4,4b,5,8a,9,10,10a-octahydrophenanthrene-2,6-dione.
| Compound Name | 7-ethenyl-1,1,4a,8-tetramethyl-3,4,4b,5,8a,9,10,10a-octahydrophenanthrene-2,6-dione |
|---|---|
| PubChem CID | 14864253 |
| Molecular Formula | C20H28O2 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | 7-ethenyl-1,1,4a,8-tetramethyl-3,4,4b,5,8a,9,10,10a-octahydrophenanthrene-2,6-dione |
| SMILES | C=CC1=C(C)C2CCC3C(C)(C)C(=O)CCC3(C)C2CC1=O |
| InChI | InChI=1S/C20H28O2/c1-6-13-12(2)14-7-8-17-19(3,4)18(22)9-10-20(17,5)15(14)11-16(13)21/h6,14-15,17H,1,7-11H2,2-5H3 |
| InChIKey | BBORETXATUMGEZ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |