About CID 148642954
CID 148642954 (PubChem CID 148642954) has the molecular formula C11H11BN4O2
and a molecular weight of 242.05 g/mol.
Molecular Properties
| Compound Name | CID 148642954 |
| PubChem CID | 148642954 |
| Molecular Formula | C11H11BN4O2 |
| Molecular Weight | 242.05 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | — |
| SMILES | [B]c1cn2cc(C=O)nc2c(N2CCOCC2)n1 |
| InChI | InChI=1S/C11H11BN4O2/c12-9-6-16-5-8(7-17)13-10(16)11(14-9)15-1-3-18-4-2-15/h5-7H,1-4H2 |
| InChIKey | JWPAWOUWIQMOCV-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 59.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.05 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 148642954 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 148642954?
The IUPAC name of CID 148642954 (CID 148642954) is not available.
What is the SMILES notation for CID 148642954?
The canonical SMILES for CID 148642954 is [B]c1cn2cc(C=O)nc2c(N2CCOCC2)n1.
What is the InChIKey of CID 148642954?
The InChIKey is JWPAWOUWIQMOCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11BN4O2/c12-9-6-16-5-8(7-17)13-10(16)11(14-9)15-1-3-18-4-2-15/h5-7H,1-4H2.
What are the key properties of CID 148642954?
CID 148642954 has a molecular weight of 242.05 g/mol, XLogP of -0.83, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 148642954 is sourced from PubChem (CID 148642954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).