C22H42N2Si — CID 148644913
N-[butyl-methyl-(3-pyrrolidin-1-yl-2,3,4,5,6,7-hexahydro-1H-inden-1-yl)silyl]-2-methylpropan-2-amine (PubChem CID 148644913) has the molecular formula C22H42N2Si and a molecular weight of 362.68 g/mol. Its IUPAC name is N-[butyl-methyl-(3-pyrrolidin-1-yl-2,3,4,5,6,7-hexahydro-1H-inden-1-yl)silyl]-2-methylpropan-2-amine.
| Compound Name | N-[butyl-methyl-(3-pyrrolidin-1-yl-2,3,4,5,6,7-hexahydro-1H-inden-1-yl)silyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 148644913 |
| Molecular Formula | C22H42N2Si |
| Molecular Weight | 362.68 g/mol |
| Exact Mass | 362.31 |
| IUPAC Name | N-[butyl-methyl-(3-pyrrolidin-1-yl-2,3,4,5,6,7-hexahydro-1H-inden-1-yl)silyl]-2-methylpropan-2-amine |
| SMILES | CCCC[Si@](C)(NC(C)(C)C)C1CC(N2CCCC2)C2=C1CCCC2 |
| InChI | InChI=1S/C22H42N2Si/c1-6-7-16-25(5,23-22(2,3)4)21-17-20(24-14-10-11-15-24)18-12-8-9-13-19(18)21/h20-21,23H,6-17H2,1-5H3/t20?,21?,25-/m0/s1 |
| InChIKey | NIIXGLPJUFMORU-BAWHURIHSA-N |
| XLogP | 5.86 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.68 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|