C24H21F4N5O2S — CID 148649515
6-[[5-fluoro-2-[5-(4,4,4-trifluorobutanoyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl]pyrimidin-4-yl]amino]-3,4-dihydro-2H-isoquinolin-1-one (PubChem CID 148649515) has the molecular formula C24H21F4N5O2S and a molecular weight of 519.52 g/mol. Its IUPAC name is 6-[[5-fluoro-2-[5-(4,4,4-trifluorobutanoyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl]pyrimidin-4-yl]amino]-3,4-dihydro-2H-isoquinolin-1-one.
| Compound Name | 6-[[5-fluoro-2-[5-(4,4,4-trifluorobutanoyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl]pyrimidin-4-yl]amino]-3,4-dihydro-2H-isoquinolin-1-one |
|---|---|
| PubChem CID | 148649515 |
| Molecular Formula | C24H21F4N5O2S |
| Molecular Weight | 519.52 g/mol |
| Exact Mass | 519.14 |
| IUPAC Name | 6-[[5-fluoro-2-[5-(4,4,4-trifluorobutanoyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl]pyrimidin-4-yl]amino]-3,4-dihydro-2H-isoquinolin-1-one |
| SMILES | O=C1NCCc2cc(Nc3nc(-c4cc5c(s4)CCN(C(=O)CCC(F)(F)F)C5)ncc3F)ccc21 |
| InChI | InChI=1S/C24H21F4N5O2S/c25-17-11-30-22(32-21(17)31-15-1-2-16-13(9-15)4-7-29-23(16)35)19-10-14-12-33(8-5-18(14)36-19)20(34)3-6-24(26,27)28/h1-2,9-11H,3-8,12H2,(H,29,35)(H,30,31,32) |
| InChIKey | NLQNAARYZSMOQM-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.52 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |