C24H30ClN3O3 — CID 148649521
(2R,4S)-4-benzyl-N-[(2S)-1-[(5-chloro-2-hydroxy-3-methylphenyl)methylamino]-1-oxopropan-2-yl]piperidine-2-carboxamide (PubChem CID 148649521) has the molecular formula C24H30ClN3O3 and a molecular weight of 444.00 g/mol. Its IUPAC name is (2R,4S)-4-benzyl-N-[(2S)-1-[(5-chloro-2-hydroxy-3-methylphenyl)methylamino]-1-oxopropan-2-yl]piperidine-2-carboxamide.
| Compound Name | (2R,4S)-4-benzyl-N-[(2S)-1-[(5-chloro-2-hydroxy-3-methylphenyl)methylamino]-1-oxopropan-2-yl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 148649521 |
| Molecular Formula | C24H30ClN3O3 |
| Molecular Weight | 444.00 g/mol |
| Exact Mass | 443.20 |
| IUPAC Name | (2R,4S)-4-benzyl-N-[(2S)-1-[(5-chloro-2-hydroxy-3-methylphenyl)methylamino]-1-oxopropan-2-yl]piperidine-2-carboxamide |
| SMILES | CC1=CC(=CC(=C1O)CNC(=O)[C@H](C)NC(=O)[C@H]2C[C@H](CCN2)CC3=CC=CC=C3)Cl |
| InChI | InChI=1S/C24H30ClN3O3/c1-15-10-20(25)13-19(22(15)29)14-27-23(30)16(2)28-24(31)21-12-18(8-9-26-21)11-17-6-4-3-5-7-17/h3-7,10,13,16,18,21,26,29H,8-9,11-12,14H2,1-2H3,(H,27,30)(H,28,31)/t16-,18+,21+/m0/s1 |
| InChIKey | NLQOFJLFWDDVMX-YRISNDGFSA-N |
| XLogP | 4.30 |
| TPSA | 90.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | 599 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.00 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|