C7H9N5 — CID 1486544
1-[(1R)-1-(1H-pyrazol-5-yl)ethyl]-1,2,4-triazole (PubChem CID 1486544) has the molecular formula C7H9N5 and a molecular weight of 163.18 g/mol. Its IUPAC name is 1-[(1R)-1-(1H-pyrazol-5-yl)ethyl]-1,2,4-triazole.
| Compound Name | 1-[(1R)-1-(1H-pyrazol-5-yl)ethyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 1486544 |
| Molecular Formula | C7H9N5 |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.09 |
| IUPAC Name | 1-[(1R)-1-(1H-pyrazol-5-yl)ethyl]-1,2,4-triazole |
| SMILES | C[C@H](c1ccn[nH]1)n1cncn1 |
| InChI | InChI=1S/C7H9N5/c1-6(7-2-3-9-11-7)12-5-8-4-10-12/h2-6H,1H3,(H,9,11)/t6-/m1/s1 |
| InChIKey | JUQYUICLZWLXOV-ZCFIWIBFSA-N |
| XLogP | 0.61 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |