C20H25NO6 — CID 148656745
2-[[4-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]methyl]-2-(2-methylbutan-2-yloxy)propanedioic acid (PubChem CID 148656745) has the molecular formula C20H25NO6 and a molecular weight of 375.42 g/mol. Its IUPAC name is 2-[[4-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]methyl]-2-(2-methylbutan-2-yloxy)propanedioic acid.
| Compound Name | 2-[[4-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]methyl]-2-(2-methylbutan-2-yloxy)propanedioic acid |
|---|---|
| PubChem CID | 148656745 |
| Molecular Formula | C20H25NO6 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | 2-[[4-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]methyl]-2-(2-methylbutan-2-yloxy)propanedioic acid |
| SMILES | CCC(C)(C)OC(Cc1ccc(-c2c(C)noc2C)cc1)(C(=O)O)C(=O)O |
| InChI | InChI=1S/C20H25NO6/c1-6-19(4,5)27-20(17(22)23,18(24)25)11-14-7-9-15(10-8-14)16-12(2)21-26-13(16)3/h7-10H,6,11H2,1-5H3,(H,22,23)(H,24,25) |
| InChIKey | NMZKWHYNMCLNLD-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 109.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|