C20H25BCl2N2O4 — CID 148657062
6-[2,6-dichloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-2-methyl-4-propan-2-ylpyridazin-3-one (PubChem CID 148657062) has the molecular formula C20H25BCl2N2O4 and a molecular weight of 439.15 g/mol. Its IUPAC name is 6-[2,6-dichloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-2-methyl-4-propan-2-ylpyridazin-3-one.
| Compound Name | 6-[2,6-dichloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-2-methyl-4-propan-2-ylpyridazin-3-one |
|---|---|
| PubChem CID | 148657062 |
| Molecular Formula | C20H25BCl2N2O4 |
| Molecular Weight | 439.15 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | 6-[2,6-dichloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-2-methyl-4-propan-2-ylpyridazin-3-one |
| SMILES | CC(C)c1cc(Oc2c(Cl)cc(B3OC(C)(C)C(C)(C)O3)cc2Cl)nn(C)c1=O |
| InChI | InChI=1S/C20H25BCl2N2O4/c1-11(2)13-10-16(24-25(7)18(13)26)27-17-14(22)8-12(9-15(17)23)21-28-19(3,4)20(5,6)29-21/h8-11H,1-7H3 |
| InChIKey | NNBDRHRYGWONRW-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.15 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|