About 2-butoxyethyl pyridine-3-carboxylate
2-butoxyethyl pyridine-3-carboxylate (PubChem CID 14866) has the molecular formula C12H17NO3
and a molecular weight of 223.27 g/mol. Its IUPAC name is 2-butoxyethyl pyridine-3-carboxylate.
Molecular Properties
| Compound Name | 2-butoxyethyl pyridine-3-carboxylate |
| PubChem CID | 14866 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | 2-butoxyethyl pyridine-3-carboxylate |
| SMILES | CCCCOCCOC(=O)c1cccnc1 |
| InChI | InChI=1S/C12H17NO3/c1-2-3-7-15-8-9-16-12(14)11-5-4-6-13-10-11/h4-6,10H,2-3,7-9H2,1H3 |
| InChIKey | IZJRISIINLJVBU-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-butoxyethyl pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butoxyethyl pyridine-3-carboxylate?
The IUPAC name of 2-butoxyethyl pyridine-3-carboxylate (CID 14866) is 2-butoxyethyl pyridine-3-carboxylate.
What is the SMILES notation for 2-butoxyethyl pyridine-3-carboxylate?
The canonical SMILES for 2-butoxyethyl pyridine-3-carboxylate is CCCCOCCOC(=O)c1cccnc1.
What is the InChIKey of 2-butoxyethyl pyridine-3-carboxylate?
The InChIKey is IZJRISIINLJVBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO3/c1-2-3-7-15-8-9-16-12(14)11-5-4-6-13-10-11/h4-6,10H,2-3,7-9H2,1H3.
What are the key properties of 2-butoxyethyl pyridine-3-carboxylate?
2-butoxyethyl pyridine-3-carboxylate has a molecular weight of 223.27 g/mol, XLogP of 2.06, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butoxyethyl pyridine-3-carboxylate is sourced from PubChem (CID 14866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).