C21H36O — CID 14866453
1,1-bis(1-bicyclo[2.2.2]octanyl)-2,2-dimethylpropan-1-ol (PubChem CID 14866453) has the molecular formula C21H36O and a molecular weight of 304.52 g/mol. Its IUPAC name is 1,1-bis(1-bicyclo[2.2.2]octanyl)-2,2-dimethylpropan-1-ol.
| Compound Name | 1,1-bis(1-bicyclo[2.2.2]octanyl)-2,2-dimethylpropan-1-ol |
|---|---|
| PubChem CID | 14866453 |
| Molecular Formula | C21H36O |
| Molecular Weight | 304.52 g/mol |
| Exact Mass | 304.28 |
| IUPAC Name | 1,1-bis(1-bicyclo[2.2.2]octanyl)-2,2-dimethylpropan-1-ol |
| SMILES | CC(C)(C)C(O)(C12CCC(CC1)CC2)C12CCC(CC1)CC2 |
| InChI | InChI=1S/C21H36O/c1-18(2,3)21(22,19-10-4-16(5-11-19)6-12-19)20-13-7-17(8-14-20)9-15-20/h16-17,22H,4-15H2,1-3H3 |
| InChIKey | CWLFNKONLDABTF-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.52 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |