C13H13FN6O — CID 148664964
N-(cyanomethyl)-3-fluoro-1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrrolidine-3-carboxamide (PubChem CID 148664964) has the molecular formula C13H13FN6O and a molecular weight of 288.29 g/mol. Its IUPAC name is N-(cyanomethyl)-3-fluoro-1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrrolidine-3-carboxamide.
| Compound Name | N-(cyanomethyl)-3-fluoro-1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 148664964 |
| Molecular Formula | C13H13FN6O |
| Molecular Weight | 288.29 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | N-(cyanomethyl)-3-fluoro-1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrrolidine-3-carboxamide |
| SMILES | N#CCNC(=O)C1(F)CCN(c2ncnc3[nH]ccc23)C1 |
| InChI | InChI=1S/C13H13FN6O/c14-13(12(21)17-5-3-15)2-6-20(7-13)11-9-1-4-16-10(9)18-8-19-11/h1,4,8H,2,5-7H2,(H,17,21)(H,16,18,19) |
| InChIKey | NONYNUUERMXMNT-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 97.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.29 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|