C33H35BClN3O2 — CID 148666124
9-[3-[2-chloro-5-(6-methyl-2-pyridinyl)-4-pyridinyl]-2-methylpropyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazole (PubChem CID 148666124) has the molecular formula C33H35BClN3O2 and a molecular weight of 551.93 g/mol. Its IUPAC name is 9-[3-[2-chloro-5-(6-methyl-2-pyridinyl)-4-pyridinyl]-2-methylpropyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazole.
| Compound Name | 9-[3-[2-chloro-5-(6-methyl-2-pyridinyl)-4-pyridinyl]-2-methylpropyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazole |
|---|---|
| PubChem CID | 148666124 |
| Molecular Formula | C33H35BClN3O2 |
| Molecular Weight | 551.93 g/mol |
| Exact Mass | 551.25 |
| IUPAC Name | 9-[3-[2-chloro-5-(6-methyl-2-pyridinyl)-4-pyridinyl]-2-methylpropyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazole |
| SMILES | Cc1cccc(-c2cnc(Cl)cc2CC(C)Cn2c3ccccc3c3ccc(B4OC(C)(C)C(C)(C)O4)cc32)n1 |
| InChI | InChI=1S/C33H35BClN3O2/c1-21(16-23-17-31(35)36-19-27(23)28-12-9-10-22(2)37-28)20-38-29-13-8-7-11-25(29)26-15-14-24(18-30(26)38)34-39-32(3,4)33(5,6)40-34/h7-15,17-19,21H,16,20H2,1-6H3 |
| InChIKey | NOTKSUJJIYPDDN-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.93 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|