C7H8F3N2O2+ — CID 148669369
2-hydroxy-1,3-dimethyl-6-(trifluoromethyl)pyrimidin-1-ium-4-one (PubChem CID 148669369) has the molecular formula C7H8F3N2O2+ and a molecular weight of 209.15 g/mol. Its IUPAC name is 2-hydroxy-1,3-dimethyl-6-(trifluoromethyl)pyrimidin-1-ium-4-one.
| Compound Name | 2-hydroxy-1,3-dimethyl-6-(trifluoromethyl)pyrimidin-1-ium-4-one |
|---|---|
| PubChem CID | 148669369 |
| Molecular Formula | C7H8F3N2O2+ |
| Molecular Weight | 209.15 g/mol |
| Exact Mass | 209.05 |
| IUPAC Name | 2-hydroxy-1,3-dimethyl-6-(trifluoromethyl)pyrimidin-1-ium-4-one |
| SMILES | Cn1c(O)[n+](C)c(C(F)(F)F)cc1=O |
| InChI | InChI=1S/C7H7F3N2O2/c1-11-4(7(8,9)10)3-5(13)12(2)6(11)14/h3H,1-2H3/p+1 |
| InChIKey | NPJVLHHOGCGSIG-UHFFFAOYSA-O |
| XLogP | -0.07 |
| TPSA | 46.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.15 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|