About bicyclo[2.1.1]hexan-1-ol
bicyclo[2.1.1]hexan-1-ol (PubChem CID 14867020) has the molecular formula C6H10O
and a molecular weight of 98.15 g/mol. Its IUPAC name is bicyclo[2.1.1]hexan-1-ol.
Molecular Properties
| Compound Name | bicyclo[2.1.1]hexan-1-ol |
| PubChem CID | 14867020 |
| Molecular Formula | C6H10O |
| Molecular Weight | 98.15 g/mol |
| Exact Mass | 98.07 |
| IUPAC Name | bicyclo[2.1.1]hexan-1-ol |
| SMILES | OC12CCC(C1)C2 |
| InChI | InChI=1S/C6H10O/c7-6-2-1-5(3-6)4-6/h5,7H,1-4H2 |
| InChIKey | VSFNIRMYWJSEFH-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 98.15 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze bicyclo[2.1.1]hexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[2.1.1]hexan-1-ol?
The IUPAC name of bicyclo[2.1.1]hexan-1-ol (CID 14867020) is bicyclo[2.1.1]hexan-1-ol.
What is the SMILES notation for bicyclo[2.1.1]hexan-1-ol?
The canonical SMILES for bicyclo[2.1.1]hexan-1-ol is OC12CCC(C1)C2.
What is the InChIKey of bicyclo[2.1.1]hexan-1-ol?
The InChIKey is VSFNIRMYWJSEFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O/c7-6-2-1-5(3-6)4-6/h5,7H,1-4H2.
What are the key properties of bicyclo[2.1.1]hexan-1-ol?
bicyclo[2.1.1]hexan-1-ol has a molecular weight of 98.15 g/mol, XLogP of 0.92, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[2.1.1]hexan-1-ol is sourced from PubChem (CID 14867020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).