C17H14N3Y- — CID 148670419
N-(4-methylbenzene-5-id-1-yl)-6-phenylpyrimidin-4-amine;yttrium (PubChem CID 148670419) has the molecular formula C17H14N3Y- and a molecular weight of 349.23 g/mol. Its IUPAC name is N-(4-methylbenzene-5-id-1-yl)-6-phenylpyrimidin-4-amine;yttrium.
| Compound Name | N-(4-methylbenzene-5-id-1-yl)-6-phenylpyrimidin-4-amine;yttrium |
|---|---|
| PubChem CID | 148670419 |
| Molecular Formula | C17H14N3Y- |
| Molecular Weight | 349.23 g/mol |
| Exact Mass | 349.03 |
| IUPAC Name | N-(4-methylbenzene-5-id-1-yl)-6-phenylpyrimidin-4-amine;yttrium |
| SMILES | Cc1[c-]cc(Nc2cc(-c3ccccc3)ncn2)cc1.[Y] |
| InChI | InChI=1S/C17H14N3.Y/c1-13-7-9-15(10-8-13)20-17-11-16(18-12-19-17)14-5-3-2-4-6-14;/h2-7,9-12H,1H3,(H,18,19,20);/q-1; |
| InChIKey | FTZJLGZURTWVJC-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.23 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|