About (Z)-3-(4-chlorophenyl)-N-diethoxyphosphoryl-1,3-thiazetidin-2-imine
(Z)-3-(4-chlorophenyl)-N-diethoxyphosphoryl-1,3-thiazetidin-2-imine (PubChem CID 14867422) has the molecular formula C12H16ClN2O3PS
and a molecular weight of 334.77 g/mol. Its IUPAC name is (Z)-3-(4-chlorophenyl)-N-diethoxyphosphoryl-1,3-thiazetidin-2-imine.
Molecular Properties
| Compound Name | (Z)-3-(4-chlorophenyl)-N-diethoxyphosphoryl-1,3-thiazetidin-2-imine |
| PubChem CID | 14867422 |
| Molecular Formula | C12H16ClN2O3PS |
| Molecular Weight | 334.77 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | (Z)-3-(4-chlorophenyl)-N-diethoxyphosphoryl-1,3-thiazetidin-2-imine |
| SMILES | CCOP(=O)(/N=C1\SCN1c1ccc(Cl)cc1)OCC |
| InChI | InChI=1S/C12H16ClN2O3PS/c1-3-17-19(16,18-4-2)14-12-15(9-20-12)11-7-5-10(13)6-8-11/h5-8H,3-4,9H2,1-2H3/b14-12- |
| InChIKey | ZAYJODKORDEDTR-OWBHPGMISA-N |
| XLogP | 4.39 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.77 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (Z)-3-(4-chlorophenyl)-N-diethoxyphosphoryl-1,3-thiazetidin-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3-(4-chlorophenyl)-N-diethoxyphosphoryl-1,3-thiazetidin-2-imine?
The IUPAC name of (Z)-3-(4-chlorophenyl)-N-diethoxyphosphoryl-1,3-thiazetidin-2-imine (CID 14867422) is (Z)-3-(4-chlorophenyl)-N-diethoxyphosphoryl-1,3-thiazetidin-2-imine.
What is the SMILES notation for (Z)-3-(4-chlorophenyl)-N-diethoxyphosphoryl-1,3-thiazetidin-2-imine?
The canonical SMILES for (Z)-3-(4-chlorophenyl)-N-diethoxyphosphoryl-1,3-thiazetidin-2-imine is CCOP(=O)(/N=C1\SCN1c1ccc(Cl)cc1)OCC.
What is the InChIKey of (Z)-3-(4-chlorophenyl)-N-diethoxyphosphoryl-1,3-thiazetidin-2-imine?
The InChIKey is ZAYJODKORDEDTR-OWBHPGMISA-N. The full InChI is InChI=1S/C12H16ClN2O3PS/c1-3-17-19(16,18-4-2)14-12-15(9-20-12)11-7-5-10(13)6-8-11/h5-8H,3-4,9H2,1-2H3/b14-12-.
What are the key properties of (Z)-3-(4-chlorophenyl)-N-diethoxyphosphoryl-1,3-thiazetidin-2-imine?
(Z)-3-(4-chlorophenyl)-N-diethoxyphosphoryl-1,3-thiazetidin-2-imine has a molecular weight of 334.77 g/mol, XLogP of 4.39, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3-(4-chlorophenyl)-N-diethoxyphosphoryl-1,3-thiazetidin-2-imine is sourced from PubChem (CID 14867422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).