About [6-(aziridin-1-yl)-5,8-dioxonaphthalen-1-yl] benzenesulfonate
[6-(aziridin-1-yl)-5,8-dioxonaphthalen-1-yl] benzenesulfonate (PubChem CID 14867497) has the molecular formula C18H13NO5S
and a molecular weight of 355.37 g/mol. Its IUPAC name is [6-(aziridin-1-yl)-5,8-dioxonaphthalen-1-yl] benzenesulfonate.
Molecular Properties
| Compound Name | [6-(aziridin-1-yl)-5,8-dioxonaphthalen-1-yl] benzenesulfonate |
| PubChem CID | 14867497 |
| Molecular Formula | C18H13NO5S |
| Molecular Weight | 355.37 g/mol |
| Exact Mass | 355.05 |
| IUPAC Name | [6-(aziridin-1-yl)-5,8-dioxonaphthalen-1-yl] benzenesulfonate |
| SMILES | O=C1C(N2CC2)=CC(=O)c2c(OS(=O)(=O)c3ccccc3)cccc21 |
| InChI | InChI=1S/C18H13NO5S/c20-15-11-14(19-9-10-19)18(21)13-7-4-8-16(17(13)15)24-25(22,23)12-5-2-1-3-6-12/h1-8,11H,9-10H2 |
| InChIKey | LZQWZAYJJNXOAC-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.37 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze [6-(aziridin-1-yl)-5,8-dioxonaphthalen-1-yl] benzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-(aziridin-1-yl)-5,8-dioxonaphthalen-1-yl] benzenesulfonate?
The IUPAC name of [6-(aziridin-1-yl)-5,8-dioxonaphthalen-1-yl] benzenesulfonate (CID 14867497) is [6-(aziridin-1-yl)-5,8-dioxonaphthalen-1-yl] benzenesulfonate.
What is the SMILES notation for [6-(aziridin-1-yl)-5,8-dioxonaphthalen-1-yl] benzenesulfonate?
The canonical SMILES for [6-(aziridin-1-yl)-5,8-dioxonaphthalen-1-yl] benzenesulfonate is O=C1C(N2CC2)=CC(=O)c2c(OS(=O)(=O)c3ccccc3)cccc21.
What is the InChIKey of [6-(aziridin-1-yl)-5,8-dioxonaphthalen-1-yl] benzenesulfonate?
The InChIKey is LZQWZAYJJNXOAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13NO5S/c20-15-11-14(19-9-10-19)18(21)13-7-4-8-16(17(13)15)24-25(22,23)12-5-2-1-3-6-12/h1-8,11H,9-10H2.
What are the key properties of [6-(aziridin-1-yl)-5,8-dioxonaphthalen-1-yl] benzenesulfonate?
[6-(aziridin-1-yl)-5,8-dioxonaphthalen-1-yl] benzenesulfonate has a molecular weight of 355.37 g/mol, XLogP of 2.03, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(aziridin-1-yl)-5,8-dioxonaphthalen-1-yl] benzenesulfonate is sourced from PubChem (CID 14867497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).