About 5-[3-[(2,5-dichlorophenyl)sulfonylmethyl]phenyl]-2H-tetrazole
5-[3-[(2,5-dichlorophenyl)sulfonylmethyl]phenyl]-2H-tetrazole (PubChem CID 148675607) has the molecular formula C14H10Cl2N4O2S
and a molecular weight of 369.23 g/mol. Its IUPAC name is 5-[3-[(2,5-dichlorophenyl)sulfonylmethyl]phenyl]-2H-tetrazole.
Molecular Properties
| Compound Name | 5-[3-[(2,5-dichlorophenyl)sulfonylmethyl]phenyl]-2H-tetrazole |
| PubChem CID | 148675607 |
| Molecular Formula | C14H10Cl2N4O2S |
| Molecular Weight | 369.23 g/mol |
| Exact Mass | 367.99 |
| IUPAC Name | 5-[3-[(2,5-dichlorophenyl)sulfonylmethyl]phenyl]-2H-tetrazole |
| SMILES | O=S(=O)(Cc1cccc(-c2nn[nH]n2)c1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C14H10Cl2N4O2S/c15-11-4-5-12(16)13(7-11)23(21,22)8-9-2-1-3-10(6-9)14-17-19-20-18-14/h1-7H,8H2,(H,17,18,19,20) |
| InChIKey | NQOUJMSOWIDQAB-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.23 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[3-[(2,5-dichlorophenyl)sulfonylmethyl]phenyl]-2H-tetrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3-[(2,5-dichlorophenyl)sulfonylmethyl]phenyl]-2H-tetrazole?
The IUPAC name of 5-[3-[(2,5-dichlorophenyl)sulfonylmethyl]phenyl]-2H-tetrazole (CID 148675607) is 5-[3-[(2,5-dichlorophenyl)sulfonylmethyl]phenyl]-2H-tetrazole.
What is the SMILES notation for 5-[3-[(2,5-dichlorophenyl)sulfonylmethyl]phenyl]-2H-tetrazole?
The canonical SMILES for 5-[3-[(2,5-dichlorophenyl)sulfonylmethyl]phenyl]-2H-tetrazole is O=S(=O)(Cc1cccc(-c2nn[nH]n2)c1)c1cc(Cl)ccc1Cl.
What is the InChIKey of 5-[3-[(2,5-dichlorophenyl)sulfonylmethyl]phenyl]-2H-tetrazole?
The InChIKey is NQOUJMSOWIDQAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10Cl2N4O2S/c15-11-4-5-12(16)13(7-11)23(21,22)8-9-2-1-3-10(6-9)14-17-19-20-18-14/h1-7H,8H2,(H,17,18,19,20).
What are the key properties of 5-[3-[(2,5-dichlorophenyl)sulfonylmethyl]phenyl]-2H-tetrazole?
5-[3-[(2,5-dichlorophenyl)sulfonylmethyl]phenyl]-2H-tetrazole has a molecular weight of 369.23 g/mol, XLogP of 3.15, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3-[(2,5-dichlorophenyl)sulfonylmethyl]phenyl]-2H-tetrazole is sourced from PubChem (CID 148675607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).