C16H8N2S — CID 14867653
4-thia-3,5-diazapentacyclo[9.6.2.02,6.07,19.014,18]nonadeca-1(17),2,5,7,9,11(19),12,14(18),15-nonaene (PubChem CID 14867653) has the molecular formula C16H8N2S and a molecular weight of 260.32 g/mol. Its IUPAC name is 4-thia-3,5-diazapentacyclo[9.6.2.02,6.07,19.014,18]nonadeca-1(17),2,5,7,9,11(19),12,14(18),15-nonaene.
| Compound Name | 4-thia-3,5-diazapentacyclo[9.6.2.02,6.07,19.014,18]nonadeca-1(17),2,5,7,9,11(19),12,14(18),15-nonaene |
|---|---|
| PubChem CID | 14867653 |
| Molecular Formula | C16H8N2S |
| Molecular Weight | 260.32 g/mol |
| Exact Mass | 260.04 |
| IUPAC Name | 4-thia-3,5-diazapentacyclo[9.6.2.02,6.07,19.014,18]nonadeca-1(17),2,5,7,9,11(19),12,14(18),15-nonaene |
| SMILES | c1cc2ccc3cccc4c5nsnc5c(c1)c2c34 |
| InChI | InChI=1S/C16H8N2S/c1-3-9-7-8-10-4-2-6-12-14(10)13(9)11(5-1)15-16(12)18-19-17-15/h1-8H |
| InChIKey | RSTDIKJOEIERRN-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.32 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|