C20H15Cl2F4N3O2 — CID 148678374
7-chloro-1-(2-chloro-6-fluorophenyl)-3-[[[(1S)-1-cyclopropyl-2,2,2-trifluoroethyl]amino]-hydroxymethyl]-1,8-naphthyridin-4-one (PubChem CID 148678374) has the molecular formula C20H15Cl2F4N3O2 and a molecular weight of 476.26 g/mol. Its IUPAC name is 7-chloro-1-(2-chloro-6-fluorophenyl)-3-[[[(1S)-1-cyclopropyl-2,2,2-trifluoroethyl]amino]-hydroxymethyl]-1,8-naphthyridin-4-one.
| Compound Name | 7-chloro-1-(2-chloro-6-fluorophenyl)-3-[[[(1S)-1-cyclopropyl-2,2,2-trifluoroethyl]amino]-hydroxymethyl]-1,8-naphthyridin-4-one |
|---|---|
| PubChem CID | 148678374 |
| Molecular Formula | C20H15Cl2F4N3O2 |
| Molecular Weight | 476.26 g/mol |
| Exact Mass | 475.05 |
| IUPAC Name | 7-chloro-1-(2-chloro-6-fluorophenyl)-3-[[[(1S)-1-cyclopropyl-2,2,2-trifluoroethyl]amino]-hydroxymethyl]-1,8-naphthyridin-4-one |
| SMILES | O=c1c(C(O)N[C@@H](C2CC2)C(F)(F)F)cn(-c2c(F)cccc2Cl)c2nc(Cl)ccc12 |
| InChI | InChI=1S/C20H15Cl2F4N3O2/c21-12-2-1-3-13(23)15(12)29-8-11(16(30)10-6-7-14(22)27-18(10)29)19(31)28-17(9-4-5-9)20(24,25)26/h1-3,6-9,17,19,28,31H,4-5H2/t17-,19?/m0/s1 |
| InChIKey | NRCGWPAGXPENQQ-KKFHFHRHSA-N |
| XLogP | 4.75 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.26 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|