C24H24F3N7O2 — CID 148679033
(9S)-N-[4-(3-methylimidazol-4-yl)-2-pyridinyl]-5-[(3S)-4,4,4-trifluoro-3-methylbutanoyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide (PubChem CID 148679033) has the molecular formula C24H24F3N7O2 and a molecular weight of 499.50 g/mol. Its IUPAC name is (9S)-N-[4-(3-methylimidazol-4-yl)-2-pyridinyl]-5-[(3S)-4,4,4-trifluoro-3-methylbutanoyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide.
| Compound Name | (9S)-N-[4-(3-methylimidazol-4-yl)-2-pyridinyl]-5-[(3S)-4,4,4-trifluoro-3-methylbutanoyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 148679033 |
| Molecular Formula | C24H24F3N7O2 |
| Molecular Weight | 499.50 g/mol |
| Exact Mass | 499.19 |
| IUPAC Name | (9S)-N-[4-(3-methylimidazol-4-yl)-2-pyridinyl]-5-[(3S)-4,4,4-trifluoro-3-methylbutanoyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
| SMILES | C[C@@H](CC(=O)c1ccc2c(n1)N(C(=O)Nc1cc(-c3cncn3C)ccn1)[C@H]1CCN2C1)C(F)(F)F |
| InChI | InChI=1S/C24H24F3N7O2/c1-14(24(25,26)27)9-20(35)17-3-4-18-22(30-17)34(16-6-8-33(18)12-16)23(36)31-21-10-15(5-7-29-21)19-11-28-13-32(19)2/h3-5,7,10-11,13-14,16H,6,8-9,12H2,1-2H3,(H,29,31,36)/t14-,16-/m0/s1 |
| InChIKey | NRFLCAYVVPUIMP-HOCLYGCPSA-N |
| XLogP | 4.28 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.50 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |