C35H28N6O3 — CID 14868171
(8aR)-6-(4-methoxyphenyl)-1-(4-nitrophenyl)-3,8,8a-triphenyl-5H-[1,2,4]triazolo[4,3-d][1,2,4]triazine (PubChem CID 14868171) has the molecular formula C35H28N6O3 and a molecular weight of 580.65 g/mol. Its IUPAC name is (8aR)-6-(4-methoxyphenyl)-1-(4-nitrophenyl)-3,8,8a-triphenyl-5H-[1,2,4]triazolo[4,3-d][1,2,4]triazine.
| Compound Name | (8aR)-6-(4-methoxyphenyl)-1-(4-nitrophenyl)-3,8,8a-triphenyl-5H-[1,2,4]triazolo[4,3-d][1,2,4]triazine |
|---|---|
| PubChem CID | 14868171 |
| Molecular Formula | C35H28N6O3 |
| Molecular Weight | 580.65 g/mol |
| Exact Mass | 580.22 |
| IUPAC Name | (8aR)-6-(4-methoxyphenyl)-1-(4-nitrophenyl)-3,8,8a-triphenyl-5H-[1,2,4]triazolo[4,3-d][1,2,4]triazine |
| SMILES | COc1ccc(N2CN3C(c4ccccc4)=NN(c4ccc([N+](=O)[O-])cc4)[C@]3(c3ccccc3)C(c3ccccc3)=N2)cc1 |
| InChI | InChI=1S/C35H28N6O3/c1-44-32-23-21-29(22-24-32)39-25-38-34(27-13-7-3-8-14-27)37-40(30-17-19-31(20-18-30)41(42)43)35(38,28-15-9-4-10-16-28)33(36-39)26-11-5-2-6-12-26/h2-24H,25H2,1H3/t35-/m1/s1 |
| InChIKey | DMHPJIPYXQJIEP-PGUFJCEWSA-N |
| XLogP | 6.82 |
| TPSA | 86.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.65 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|