C33H28N8O — CID 148683213
6-[5-[4-(4-cyclobutyl-1,2,4-triazol-3-yl)phenyl]-3-pyridinyl]-8-methyl-11-pyridin-2-yl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraen-10-one (PubChem CID 148683213) has the molecular formula C33H28N8O and a molecular weight of 552.64 g/mol. Its IUPAC name is 6-[5-[4-(4-cyclobutyl-1,2,4-triazol-3-yl)phenyl]-3-pyridinyl]-8-methyl-11-pyridin-2-yl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraen-10-one.
| Compound Name | 6-[5-[4-(4-cyclobutyl-1,2,4-triazol-3-yl)phenyl]-3-pyridinyl]-8-methyl-11-pyridin-2-yl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraen-10-one |
|---|---|
| PubChem CID | 148683213 |
| Molecular Formula | C33H28N8O |
| Molecular Weight | 552.64 g/mol |
| Exact Mass | 552.24 |
| IUPAC Name | 6-[5-[4-(4-cyclobutyl-1,2,4-triazol-3-yl)phenyl]-3-pyridinyl]-8-methyl-11-pyridin-2-yl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraen-10-one |
| SMILES | Cc1c2n(c3nccc(-c4cncc(-c5ccc(-c6nncn6C6CCC6)cc5)c4)c13)CCN(c1ccccn1)C2=O |
| InChI | InChI=1S/C33H28N8O/c1-21-29-27(12-14-36-32(29)40-16-15-39(33(42)30(21)40)28-7-2-3-13-35-28)25-17-24(18-34-19-25)22-8-10-23(11-9-22)31-38-37-20-41(31)26-5-4-6-26/h2-3,7-14,17-20,26H,4-6,15-16H2,1H3 |
| InChIKey | NSAIJSYGLLKEQB-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 94.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.64 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|