C15H15N3O3 — CID 148685894
4-[5-amino-2-(dideuteriomethyl)-4-oxoquinazolin-3-yl]-6-deuteriocyclohexane-1,3-dione (PubChem CID 148685894) has the molecular formula C15H15N3O3 and a molecular weight of 288.32 g/mol. Its IUPAC name is 4-[5-amino-2-(dideuteriomethyl)-4-oxoquinazolin-3-yl]-6-deuteriocyclohexane-1,3-dione.
| Compound Name | 4-[5-amino-2-(dideuteriomethyl)-4-oxoquinazolin-3-yl]-6-deuteriocyclohexane-1,3-dione |
|---|---|
| PubChem CID | 148685894 |
| Molecular Formula | C15H15N3O3 |
| Molecular Weight | 288.32 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | 4-[5-amino-2-(dideuteriomethyl)-4-oxoquinazolin-3-yl]-6-deuteriocyclohexane-1,3-dione |
| SMILES | [2H]C1CC(n2c(C([2H])[2H])nc3cccc(N)c3c2=O)C(=O)CC1=O |
| InChI | InChI=1S/C15H15N3O3/c1-8-17-11-4-2-3-10(16)14(11)15(21)18(8)12-6-5-9(19)7-13(12)20/h2-4,12H,5-7,16H2,1H3/i1D2,5D |
| InChIKey | NSMXTYLULUVQLE-WSWICNJZSA-N |
| XLogP | 1.15 |
| TPSA | 95.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.32 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|