C23H23FN4O2 — CID 148686273
2-[3-[(4S)-2-amino-4-methyl-4a,5,6,7,8,8a-hexahydro-1,3-benzoxazin-4-yl]-4-fluorophenyl]-1-(5-isocyano-2-pyridinyl)ethanone (PubChem CID 148686273) has the molecular formula C23H23FN4O2 and a molecular weight of 406.46 g/mol. Its IUPAC name is 2-[3-[(4S)-2-amino-4-methyl-4a,5,6,7,8,8a-hexahydro-1,3-benzoxazin-4-yl]-4-fluorophenyl]-1-(5-isocyano-2-pyridinyl)ethanone.
| Compound Name | 2-[3-[(4S)-2-amino-4-methyl-4a,5,6,7,8,8a-hexahydro-1,3-benzoxazin-4-yl]-4-fluorophenyl]-1-(5-isocyano-2-pyridinyl)ethanone |
|---|---|
| PubChem CID | 148686273 |
| Molecular Formula | C23H23FN4O2 |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | 2-[3-[(4S)-2-amino-4-methyl-4a,5,6,7,8,8a-hexahydro-1,3-benzoxazin-4-yl]-4-fluorophenyl]-1-(5-isocyano-2-pyridinyl)ethanone |
| SMILES | [C-]#[N+]c1ccc(C(=O)Cc2ccc(F)c([C@@]3(C)N=C(N)OC4CCCCC43)c2)nc1 |
| InChI | InChI=1S/C23H23FN4O2/c1-23(16-5-3-4-6-21(16)30-22(25)28-23)17-11-14(7-9-18(17)24)12-20(29)19-10-8-15(26-2)13-27-19/h7-11,13,16,21H,3-6,12H2,1H3,(H2,25,28)/t16?,21?,23-/m0/s1 |
| InChIKey | NSOQDPBGANNNPV-WWRGRJRASA-N |
| XLogP | 4.32 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|