About 3-methylsulfonylpropyl trifluoromethanesulfonate
3-methylsulfonylpropyl trifluoromethanesulfonate (PubChem CID 14868730) has the molecular formula C5H9F3O5S2
and a molecular weight of 270.25 g/mol. Its IUPAC name is 3-methylsulfonylpropyl trifluoromethanesulfonate.
Molecular Properties
| Compound Name | 3-methylsulfonylpropyl trifluoromethanesulfonate |
| PubChem CID | 14868730 |
| Molecular Formula | C5H9F3O5S2 |
| Molecular Weight | 270.25 g/mol |
| Exact Mass | 269.98 |
| IUPAC Name | 3-methylsulfonylpropyl trifluoromethanesulfonate |
| SMILES | CS(=O)(=O)CCCOS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C5H9F3O5S2/c1-14(9,10)4-2-3-13-15(11,12)5(6,7)8/h2-4H2,1H3 |
| InChIKey | IZKMFWJYOYFXQB-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.25 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze 3-methylsulfonylpropyl trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylsulfonylpropyl trifluoromethanesulfonate?
The IUPAC name of 3-methylsulfonylpropyl trifluoromethanesulfonate (CID 14868730) is 3-methylsulfonylpropyl trifluoromethanesulfonate.
What is the SMILES notation for 3-methylsulfonylpropyl trifluoromethanesulfonate?
The canonical SMILES for 3-methylsulfonylpropyl trifluoromethanesulfonate is CS(=O)(=O)CCCOS(=O)(=O)C(F)(F)F.
What is the InChIKey of 3-methylsulfonylpropyl trifluoromethanesulfonate?
The InChIKey is IZKMFWJYOYFXQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9F3O5S2/c1-14(9,10)4-2-3-13-15(11,12)5(6,7)8/h2-4H2,1H3.
What are the key properties of 3-methylsulfonylpropyl trifluoromethanesulfonate?
3-methylsulfonylpropyl trifluoromethanesulfonate has a molecular weight of 270.25 g/mol, XLogP of 0.29, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylsulfonylpropyl trifluoromethanesulfonate is sourced from PubChem (CID 14868730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).