C10H17ClF3N3O2S — CID 14868946
N-[3-(2,3-dimethylimidazol-3-ium-1-yl)propyl]-1,1,1-trifluoro-N-methylmethanesulfonamide chloride (PubChem CID 14868946) has the molecular formula C10H17ClF3N3O2S and a molecular weight of 335.78 g/mol. Its IUPAC name is N-[3-(2,3-dimethylimidazol-3-ium-1-yl)propyl]-1,1,1-trifluoro-N-methylmethanesulfonamide chloride.
| Compound Name | N-[3-(2,3-dimethylimidazol-3-ium-1-yl)propyl]-1,1,1-trifluoro-N-methylmethanesulfonamide chloride |
|---|---|
| PubChem CID | 14868946 |
| Molecular Formula | C10H17ClF3N3O2S |
| Molecular Weight | 335.78 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | N-[3-(2,3-dimethylimidazol-3-ium-1-yl)propyl]-1,1,1-trifluoro-N-methylmethanesulfonamide chloride |
| SMILES | Cc1n(CCCN(C)S(=O)(=O)C(F)(F)F)cc[n+]1C.[Cl-] |
| InChI | InChI=1S/C10H17F3N3O2S.ClH/c1-9-14(2)7-8-16(9)6-4-5-15(3)19(17,18)10(11,12)13;/h7-8H,4-6H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | DKDKFDBZQABERA-UHFFFAOYSA-M |
| XLogP | -2.20 |
| TPSA | 46.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.78 |
| LogP ≤ 5 | -2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|