C12H26BOSi- — CID 14868957
2,4,5,5-tetraethyl-2,3-dimethyl-1-oxa-2-sila-5-boranuidacyclopent-3-ene (PubChem CID 14868957) has the molecular formula C12H26BOSi- and a molecular weight of 225.24 g/mol. Its IUPAC name is 2,4,5,5-tetraethyl-2,3-dimethyl-1-oxa-2-sila-5-boranuidacyclopent-3-ene.
| Compound Name | 2,4,5,5-tetraethyl-2,3-dimethyl-1-oxa-2-sila-5-boranuidacyclopent-3-ene |
|---|---|
| PubChem CID | 14868957 |
| Molecular Formula | C12H26BOSi- |
| Molecular Weight | 225.24 g/mol |
| Exact Mass | 225.19 |
| IUPAC Name | 2,4,5,5-tetraethyl-2,3-dimethyl-1-oxa-2-sila-5-boranuidacyclopent-3-ene |
| SMILES | CCC1=C(C)[Si](C)(CC)O[B-]1(CC)CC |
| InChI | InChI=1S/C12H26BOSi/c1-7-12-11(5)15(6,10-4)14-13(12,8-2)9-3/h7-10H2,1-6H3/q-1 |
| InChIKey | OFTOLLDNOXYPKX-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.24 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|