About N-(2,4-difluorophenyl)-2-phenyl-1,3-thiazole-4-carboxamide
N-(2,4-difluorophenyl)-2-phenyl-1,3-thiazole-4-carboxamide (PubChem CID 1486906) has the molecular formula C16H10F2N2OS
and a molecular weight of 316.33 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-2-phenyl-1,3-thiazole-4-carboxamide.
Molecular Properties
| Compound Name | N-(2,4-difluorophenyl)-2-phenyl-1,3-thiazole-4-carboxamide |
| PubChem CID | 1486906 |
| Molecular Formula | C16H10F2N2OS |
| Molecular Weight | 316.33 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | N-(2,4-difluorophenyl)-2-phenyl-1,3-thiazole-4-carboxamide |
| SMILES | O=C(Nc1ccc(F)cc1F)c1csc(-c2ccccc2)n1 |
| InChI | InChI=1S/C16H10F2N2OS/c17-11-6-7-13(12(18)8-11)19-15(21)14-9-22-16(20-14)10-4-2-1-3-5-10/h1-9H,(H,19,21) |
| InChIKey | QPRMWNWRAPNJMU-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.33 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(2,4-difluorophenyl)-2-phenyl-1,3-thiazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,4-difluorophenyl)-2-phenyl-1,3-thiazole-4-carboxamide?
The IUPAC name of N-(2,4-difluorophenyl)-2-phenyl-1,3-thiazole-4-carboxamide (CID 1486906) is N-(2,4-difluorophenyl)-2-phenyl-1,3-thiazole-4-carboxamide.
What is the SMILES notation for N-(2,4-difluorophenyl)-2-phenyl-1,3-thiazole-4-carboxamide?
The canonical SMILES for N-(2,4-difluorophenyl)-2-phenyl-1,3-thiazole-4-carboxamide is O=C(Nc1ccc(F)cc1F)c1csc(-c2ccccc2)n1.
What is the InChIKey of N-(2,4-difluorophenyl)-2-phenyl-1,3-thiazole-4-carboxamide?
The InChIKey is QPRMWNWRAPNJMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10F2N2OS/c17-11-6-7-13(12(18)8-11)19-15(21)14-9-22-16(20-14)10-4-2-1-3-5-10/h1-9H,(H,19,21).
What are the key properties of N-(2,4-difluorophenyl)-2-phenyl-1,3-thiazole-4-carboxamide?
N-(2,4-difluorophenyl)-2-phenyl-1,3-thiazole-4-carboxamide has a molecular weight of 316.33 g/mol, XLogP of 4.34, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,4-difluorophenyl)-2-phenyl-1,3-thiazole-4-carboxamide is sourced from PubChem (CID 1486906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).