About 2-amino-4-methyl-N-(1,3-thiazol-2-yl)pyrimidine-5-carboxamide
2-amino-4-methyl-N-(1,3-thiazol-2-yl)pyrimidine-5-carboxamide (PubChem CID 1486933) has the molecular formula C9H9N5OS
and a molecular weight of 235.27 g/mol. Its IUPAC name is 2-amino-4-methyl-N-(1,3-thiazol-2-yl)pyrimidine-5-carboxamide.
Molecular Properties
| Compound Name | 2-amino-4-methyl-N-(1,3-thiazol-2-yl)pyrimidine-5-carboxamide |
| PubChem CID | 1486933 |
| Molecular Formula | C9H9N5OS |
| Molecular Weight | 235.27 g/mol |
| Exact Mass | 235.05 |
| IUPAC Name | 2-amino-4-methyl-N-(1,3-thiazol-2-yl)pyrimidine-5-carboxamide |
| SMILES | Cc1nc(N)ncc1C(=O)Nc1nccs1 |
| InChI | InChI=1S/C9H9N5OS/c1-5-6(4-12-8(10)13-5)7(15)14-9-11-2-3-16-9/h2-4H,1H3,(H2,10,12,13)(H,11,14,15) |
| InChIKey | SEDDRAFPMKXNDR-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.27 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-amino-4-methyl-N-(1,3-thiazol-2-yl)pyrimidine-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4-methyl-N-(1,3-thiazol-2-yl)pyrimidine-5-carboxamide?
The IUPAC name of 2-amino-4-methyl-N-(1,3-thiazol-2-yl)pyrimidine-5-carboxamide (CID 1486933) is 2-amino-4-methyl-N-(1,3-thiazol-2-yl)pyrimidine-5-carboxamide.
What is the SMILES notation for 2-amino-4-methyl-N-(1,3-thiazol-2-yl)pyrimidine-5-carboxamide?
The canonical SMILES for 2-amino-4-methyl-N-(1,3-thiazol-2-yl)pyrimidine-5-carboxamide is Cc1nc(N)ncc1C(=O)Nc1nccs1.
What is the InChIKey of 2-amino-4-methyl-N-(1,3-thiazol-2-yl)pyrimidine-5-carboxamide?
The InChIKey is SEDDRAFPMKXNDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N5OS/c1-5-6(4-12-8(10)13-5)7(15)14-9-11-2-3-16-9/h2-4H,1H3,(H2,10,12,13)(H,11,14,15).
What are the key properties of 2-amino-4-methyl-N-(1,3-thiazol-2-yl)pyrimidine-5-carboxamide?
2-amino-4-methyl-N-(1,3-thiazol-2-yl)pyrimidine-5-carboxamide has a molecular weight of 235.27 g/mol, XLogP of 1.08, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-methyl-N-(1,3-thiazol-2-yl)pyrimidine-5-carboxamide is sourced from PubChem (CID 1486933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).