About (4R,6S)-6-methyl-1-azabicyclo[2.2.2]octan-3-one;hydrochloride
(4R,6S)-6-methyl-1-azabicyclo[2.2.2]octan-3-one;hydrochloride (PubChem CID 14869404) has the molecular formula C8H14ClNO
and a molecular weight of 175.66 g/mol. Its IUPAC name is (4R,6S)-6-methyl-1-azabicyclo[2.2.2]octan-3-one;hydrochloride.
Molecular Properties
| Compound Name | (4R,6S)-6-methyl-1-azabicyclo[2.2.2]octan-3-one;hydrochloride |
| PubChem CID | 14869404 |
| Molecular Formula | C8H14ClNO |
| Molecular Weight | 175.66 g/mol |
| Exact Mass | 175.08 |
| IUPAC Name | (4R,6S)-6-methyl-1-azabicyclo[2.2.2]octan-3-one;hydrochloride |
| SMILES | C[C@H]1C[C@H]2CCN1CC2=O.Cl |
| InChI | InChI=1S/C8H13NO.ClH/c1-6-4-7-2-3-9(6)5-8(7)10;/h6-7H,2-5H2,1H3;1H/t6-,7+;/m0./s1 |
| InChIKey | FSNOGFNJUKRZJE-UOERWJHTSA-N |
| XLogP | 1.09 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.66 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4R,6S)-6-methyl-1-azabicyclo[2.2.2]octan-3-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R,6S)-6-methyl-1-azabicyclo[2.2.2]octan-3-one;hydrochloride?
The IUPAC name of (4R,6S)-6-methyl-1-azabicyclo[2.2.2]octan-3-one;hydrochloride (CID 14869404) is (4R,6S)-6-methyl-1-azabicyclo[2.2.2]octan-3-one;hydrochloride.
What is the SMILES notation for (4R,6S)-6-methyl-1-azabicyclo[2.2.2]octan-3-one;hydrochloride?
The canonical SMILES for (4R,6S)-6-methyl-1-azabicyclo[2.2.2]octan-3-one;hydrochloride is C[C@H]1C[C@H]2CCN1CC2=O.Cl.
What is the InChIKey of (4R,6S)-6-methyl-1-azabicyclo[2.2.2]octan-3-one;hydrochloride?
The InChIKey is FSNOGFNJUKRZJE-UOERWJHTSA-N. The full InChI is InChI=1S/C8H13NO.ClH/c1-6-4-7-2-3-9(6)5-8(7)10;/h6-7H,2-5H2,1H3;1H/t6-,7+;/m0./s1.
What are the key properties of (4R,6S)-6-methyl-1-azabicyclo[2.2.2]octan-3-one;hydrochloride?
(4R,6S)-6-methyl-1-azabicyclo[2.2.2]octan-3-one;hydrochloride has a molecular weight of 175.66 g/mol, XLogP of 1.09, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4R,6S)-6-methyl-1-azabicyclo[2.2.2]octan-3-one;hydrochloride is sourced from PubChem (CID 14869404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).