C19H20F3N7O2S — CID 148697075
N'-(3-aminopropyl)-4-[3-sulfamoyl-2-(3H-1,2,4-triazol-5-yl)-4-(trifluoromethyl)phenyl]benzenecarboximidamide (PubChem CID 148697075) has the molecular formula C19H20F3N7O2S and a molecular weight of 467.48 g/mol. Its IUPAC name is N'-(3-aminopropyl)-4-[3-sulfamoyl-2-(3H-1,2,4-triazol-5-yl)-4-(trifluoromethyl)phenyl]benzenecarboximidamide.
| Compound Name | N'-(3-aminopropyl)-4-[3-sulfamoyl-2-(3H-1,2,4-triazol-5-yl)-4-(trifluoromethyl)phenyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 148697075 |
| Molecular Formula | C19H20F3N7O2S |
| Molecular Weight | 467.48 g/mol |
| Exact Mass | 467.14 |
| IUPAC Name | N'-(3-aminopropyl)-4-[3-sulfamoyl-2-(3H-1,2,4-triazol-5-yl)-4-(trifluoromethyl)phenyl]benzenecarboximidamide |
| SMILES | NCCC/N=C(\N)c1ccc(-c2ccc(C(F)(F)F)c(S(N)(=O)=O)c2C2=NCN=N2)cc1 |
| InChI | InChI=1S/C19H20F3N7O2S/c20-19(21,22)14-7-6-13(15(16(14)32(25,30)31)18-27-10-28-29-18)11-2-4-12(5-3-11)17(24)26-9-1-8-23/h2-7H,1,8-10,23H2,(H2,24,26)(H2,25,30,31) |
| InChIKey | NUQFUFURCHCBOQ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 161.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.48 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|