C31H37FN6O2 — CID 148701438
4-[3-(dimethylamino)propoxy]-2-(1,6-dimethylindazol-7-yl)-3-fluoro-6-(2-prop-2-enoyl-2,7-diazaspiro[3.5]nonan-7-yl)benzonitrile (PubChem CID 148701438) has the molecular formula C31H37FN6O2 and a molecular weight of 544.68 g/mol. Its IUPAC name is 4-[3-(dimethylamino)propoxy]-2-(1,6-dimethylindazol-7-yl)-3-fluoro-6-(2-prop-2-enoyl-2,7-diazaspiro[3.5]nonan-7-yl)benzonitrile.
| Compound Name | 4-[3-(dimethylamino)propoxy]-2-(1,6-dimethylindazol-7-yl)-3-fluoro-6-(2-prop-2-enoyl-2,7-diazaspiro[3.5]nonan-7-yl)benzonitrile |
|---|---|
| PubChem CID | 148701438 |
| Molecular Formula | C31H37FN6O2 |
| Molecular Weight | 544.68 g/mol |
| Exact Mass | 544.30 |
| IUPAC Name | 4-[3-(dimethylamino)propoxy]-2-(1,6-dimethylindazol-7-yl)-3-fluoro-6-(2-prop-2-enoyl-2,7-diazaspiro[3.5]nonan-7-yl)benzonitrile |
| SMILES | C=CC(=O)N1CC2(CCN(c3cc(OCCCN(C)C)c(F)c(-c4c(C)ccc5cnn(C)c45)c3C#N)CC2)C1 |
| InChI | InChI=1S/C31H37FN6O2/c1-6-26(39)38-19-31(20-38)10-13-37(14-11-31)24-16-25(40-15-7-12-35(3)4)29(32)28(23(24)17-33)27-21(2)8-9-22-18-34-36(5)30(22)27/h6,8-9,16,18H,1,7,10-15,19-20H2,2-5H3 |
| InChIKey | NVLASFGLIZILOR-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 77.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.68 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|