About (3-iodo-1-tricyclo[3.2.1.03,6]octanyl) methyl carbonate
(3-iodo-1-tricyclo[3.2.1.03,6]octanyl) methyl carbonate (PubChem CID 148704142) has the molecular formula C10H13IO3
and a molecular weight of 308.12 g/mol. Its IUPAC name is (3-iodo-1-tricyclo[3.2.1.03,6]octanyl) methyl carbonate.
Molecular Properties
| Compound Name | (3-iodo-1-tricyclo[3.2.1.03,6]octanyl) methyl carbonate |
| PubChem CID | 148704142 |
| Molecular Formula | C10H13IO3 |
| Molecular Weight | 308.12 g/mol |
| Exact Mass | 307.99 |
| IUPAC Name | (3-iodo-1-tricyclo[3.2.1.03,6]octanyl) methyl carbonate |
| SMILES | COC(=O)OC12CC3CC(I)(C1)C3C2 |
| InChI | InChI=1S/C10H13IO3/c1-13-8(12)14-9-2-6-3-10(11,5-9)7(6)4-9/h6-7H,2-5H2,1H3 |
| InChIKey | NVYBTUDIGJVGHE-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.12 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (3-iodo-1-tricyclo[3.2.1.03,6]octanyl) methyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-iodo-1-tricyclo[3.2.1.03,6]octanyl) methyl carbonate?
The IUPAC name of (3-iodo-1-tricyclo[3.2.1.03,6]octanyl) methyl carbonate (CID 148704142) is (3-iodo-1-tricyclo[3.2.1.03,6]octanyl) methyl carbonate.
What is the SMILES notation for (3-iodo-1-tricyclo[3.2.1.03,6]octanyl) methyl carbonate?
The canonical SMILES for (3-iodo-1-tricyclo[3.2.1.03,6]octanyl) methyl carbonate is COC(=O)OC12CC3CC(I)(C1)C3C2.
What is the InChIKey of (3-iodo-1-tricyclo[3.2.1.03,6]octanyl) methyl carbonate?
The InChIKey is NVYBTUDIGJVGHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13IO3/c1-13-8(12)14-9-2-6-3-10(11,5-9)7(6)4-9/h6-7H,2-5H2,1H3.
What are the key properties of (3-iodo-1-tricyclo[3.2.1.03,6]octanyl) methyl carbonate?
(3-iodo-1-tricyclo[3.2.1.03,6]octanyl) methyl carbonate has a molecular weight of 308.12 g/mol, XLogP of 2.52, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-iodo-1-tricyclo[3.2.1.03,6]octanyl) methyl carbonate is sourced from PubChem (CID 148704142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).